About 5-(3-amino-1H-1,2,4-triazol-5-yl)-2-methyl-1H-pyridin-4-one
5-(3-amino-1H-1,2,4-triazol-5-yl)-2-methyl-1H-pyridin-4-one (PubChem CID 136812238) has the molecular formula C8H9N5O
and a molecular weight of 191.19 g/mol. Its IUPAC name is 5-(3-amino-1H-1,2,4-triazol-5-yl)-2-methyl-1H-pyridin-4-one.
Molecular Properties
| Compound Name | 5-(3-amino-1H-1,2,4-triazol-5-yl)-2-methyl-1H-pyridin-4-one |
| PubChem CID | 136812238 |
| Molecular Formula | C8H9N5O |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 5-(3-amino-1H-1,2,4-triazol-5-yl)-2-methyl-1H-pyridin-4-one |
| SMILES | Cc1cc(=O)c(-c2nc(N)n[nH]2)c[nH]1 |
| InChI | InChI=1S/C8H9N5O/c1-4-2-6(14)5(3-10-4)7-11-8(9)13-12-7/h2-3H,1H3,(H,10,14)(H3,9,11,12,13) |
| InChIKey | CJZBZURYVXGVIJ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3-amino-1H-1,2,4-triazol-5-yl)-2-methyl-1H-pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-amino-1H-1,2,4-triazol-5-yl)-2-methyl-1H-pyridin-4-one?
The IUPAC name of 5-(3-amino-1H-1,2,4-triazol-5-yl)-2-methyl-1H-pyridin-4-one (CID 136812238) is 5-(3-amino-1H-1,2,4-triazol-5-yl)-2-methyl-1H-pyridin-4-one.
What is the SMILES notation for 5-(3-amino-1H-1,2,4-triazol-5-yl)-2-methyl-1H-pyridin-4-one?
The canonical SMILES for 5-(3-amino-1H-1,2,4-triazol-5-yl)-2-methyl-1H-pyridin-4-one is Cc1cc(=O)c(-c2nc(N)n[nH]2)c[nH]1.
What is the InChIKey of 5-(3-amino-1H-1,2,4-triazol-5-yl)-2-methyl-1H-pyridin-4-one?
The InChIKey is CJZBZURYVXGVIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5O/c1-4-2-6(14)5(3-10-4)7-11-8(9)13-12-7/h2-3H,1H3,(H,10,14)(H3,9,11,12,13).
What are the key properties of 5-(3-amino-1H-1,2,4-triazol-5-yl)-2-methyl-1H-pyridin-4-one?
5-(3-amino-1H-1,2,4-triazol-5-yl)-2-methyl-1H-pyridin-4-one has a molecular weight of 191.19 g/mol, XLogP of 0.05, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-amino-1H-1,2,4-triazol-5-yl)-2-methyl-1H-pyridin-4-one is sourced from PubChem (CID 136812238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).