C10H10N4OS — CID 136812502
3-(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1H-pyridin-4-one (PubChem CID 136812502) has the molecular formula C10H10N4OS and a molecular weight of 234.28 g/mol. Its IUPAC name is 3-(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1H-pyridin-4-one.
| Compound Name | 3-(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1H-pyridin-4-one |
|---|---|
| PubChem CID | 136812502 |
| Molecular Formula | C10H10N4OS |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 3-(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1H-pyridin-4-one |
| SMILES | O=c1cc[nH]cc1-c1n[nH]c(=S)n1C1CC1 |
| InChI | InChI=1S/C10H10N4OS/c15-8-3-4-11-5-7(8)9-12-13-10(16)14(9)6-1-2-6/h3-6H,1-2H2,(H,11,15)(H,13,16) |
| InChIKey | MOGVFZAMHCOVLZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 66.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|