C16H18N4O — CID 136812792
3-[5-(aminomethyl)-1-propan-2-ylbenzimidazol-2-yl]-1H-pyridin-4-one (PubChem CID 136812792) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 3-[5-(aminomethyl)-1-propan-2-ylbenzimidazol-2-yl]-1H-pyridin-4-one.
| Compound Name | 3-[5-(aminomethyl)-1-propan-2-ylbenzimidazol-2-yl]-1H-pyridin-4-one |
|---|---|
| PubChem CID | 136812792 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 3-[5-(aminomethyl)-1-propan-2-ylbenzimidazol-2-yl]-1H-pyridin-4-one |
| SMILES | CC(C)n1c(-c2c[nH]ccc2=O)nc2cc(CN)ccc21 |
| InChI | InChI=1S/C16H18N4O/c1-10(2)20-14-4-3-11(8-17)7-13(14)19-16(20)12-9-18-6-5-15(12)21/h3-7,9-10H,8,17H2,1-2H3,(H,18,21) |
| InChIKey | AEJYOENXCDIXBU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |