C11H14N4O — CID 136812997
3-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]-1H-pyridin-4-one (PubChem CID 136812997) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]-1H-pyridin-4-one.
| Compound Name | 3-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]-1H-pyridin-4-one |
|---|---|
| PubChem CID | 136812997 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 3-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]-1H-pyridin-4-one |
| SMILES | CC(C)Cn1cnnc1-c1c[nH]ccc1=O |
| InChI | InChI=1S/C11H14N4O/c1-8(2)6-15-7-13-14-11(15)9-5-12-4-3-10(9)16/h3-5,7-8H,6H2,1-2H3,(H,12,16) |
| InChIKey | OPMMEPFATAEUAS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |