C44H45N9O3 — CID 136813119
methyl 3-[3,7,12,17-tetramethyl-18-[3-[2-[(7-methyl-6H-imidazo[4,5-f]quinolin-9-yl)amino]ethylamino]-3-oxopropyl]-22,23-dihydroporphyrin-2-yl]propanoate (PubChem CID 136813119) has the molecular formula C44H45N9O3 and a molecular weight of 747.90 g/mol. Its IUPAC name is methyl 3-[3,7,12,17-tetramethyl-18-[3-[2-[(7-methyl-6H-imidazo[4,5-f]quinolin-9-yl)amino]ethylamino]-3-oxopropyl]-22,23-dihydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[3,7,12,17-tetramethyl-18-[3-[2-[(7-methyl-6H-imidazo[4,5-f]quinolin-9-yl)amino]ethylamino]-3-oxopropyl]-22,23-dihydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 136813119 |
| Molecular Formula | C44H45N9O3 |
| Molecular Weight | 747.90 g/mol |
| Exact Mass | 747.36 |
| IUPAC Name | methyl 3-[3,7,12,17-tetramethyl-18-[3-[2-[(7-methyl-6H-imidazo[4,5-f]quinolin-9-yl)amino]ethylamino]-3-oxopropyl]-22,23-dihydroporphyrin-2-yl]propanoate |
| SMILES | COC(=O)CCC1=C(C)c2cc3[nH]c(cc3C)cc3[nH]c(cc4nc(cc1n2)C(CCC(=O)NCCNc1cc(C)[nH]c2ccc5ncnc5c12)=C4C)cc3C |
| InChI | InChI=1S/C44H45N9O3/c1-23-15-29-19-36-26(4)30(7-11-41(54)46-14-13-45-40-17-25(3)49-32-9-10-33-44(43(32)40)48-22-47-33)38(52-36)21-39-31(8-12-42(55)56-6)27(5)37(53-39)20-35-24(2)16-28(51-35)18-34(23)50-29/h9-10,15-22,45,49-51H,7-8,11-14H2,1-6H3,(H,46,54)/b28-18-,29-19-,34-18-,35-20-,36-19-,37-20-,38-21-,39-21- |
| InChIKey | FMLYTWQYNWDQRI-FZNZNHLASA-N |
| XLogP | 8.49 |
| TPSA | 166.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.90 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|