C15H13ClN2O2 — CID 136813261
2-(5-chloro-1-ethylbenzimidazol-2-yl)benzene-1,3-diol (PubChem CID 136813261) has the molecular formula C15H13ClN2O2 and a molecular weight of 288.73 g/mol. Its IUPAC name is 2-(5-chloro-1-ethylbenzimidazol-2-yl)benzene-1,3-diol.
| Compound Name | 2-(5-chloro-1-ethylbenzimidazol-2-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 136813261 |
| Molecular Formula | C15H13ClN2O2 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 2-(5-chloro-1-ethylbenzimidazol-2-yl)benzene-1,3-diol |
| SMILES | CCn1c(-c2c(O)cccc2O)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C15H13ClN2O2/c1-2-18-11-7-6-9(16)8-10(11)17-15(18)14-12(19)4-3-5-13(14)20/h3-8,19-20H,2H2,1H3 |
| InChIKey | ACKJTFYXSSXYRH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |