C9H9N5O — CID 136814334
4,8-dimethyl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one (PubChem CID 136814334) has the molecular formula C9H9N5O and a molecular weight of 203.20 g/mol. Its IUPAC name is 4,8-dimethyl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one.
| Compound Name | 4,8-dimethyl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one |
|---|---|
| PubChem CID | 136814334 |
| Molecular Formula | C9H9N5O |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 4,8-dimethyl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one |
| SMILES | Cc1nc2c3cc[nH]c3n(C)c(=O)n2n1 |
| InChI | InChI=1S/C9H9N5O/c1-5-11-8-6-3-4-10-7(6)13(2)9(15)14(8)12-5/h3-4,10H,1-2H3 |
| InChIKey | RRXQGKRRMBILEM-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |