C16H17N7O2 — CID 136814361
4-[2-[(6S)-2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pyrido[2,3-d]pyrimidin-6-yl]ethyl]benzoyl azide (PubChem CID 136814361) has the molecular formula C16H17N7O2 and a molecular weight of 339.36 g/mol. Its IUPAC name is 4-[2-[(6S)-2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pyrido[2,3-d]pyrimidin-6-yl]ethyl]benzoyl azide.
| Compound Name | 4-[2-[(6S)-2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pyrido[2,3-d]pyrimidin-6-yl]ethyl]benzoyl azide |
|---|---|
| PubChem CID | 136814361 |
| Molecular Formula | C16H17N7O2 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 4-[2-[(6S)-2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pyrido[2,3-d]pyrimidin-6-yl]ethyl]benzoyl azide |
| SMILES | [N-]=[N+]=NC(=O)c1ccc(CC[C@@H]2CNc3nc(N)[nH]c(=O)c3C2)cc1 |
| InChI | InChI=1S/C16H17N7O2/c17-16-20-13-12(15(25)21-16)7-10(8-19-13)2-1-9-3-5-11(6-4-9)14(24)22-23-18/h3-6,10H,1-2,7-8H2,(H4,17,19,20,21,25)/t10-/m0/s1 |
| InChIKey | KXCXWQMWJKCAFT-JTQLQIEISA-N |
| XLogP | 2.02 |
| TPSA | 149.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|