About CID 136814507
CID 136814507 (PubChem CID 136814507) has the molecular formula C13H34OSi4
and a molecular weight of 318.76 g/mol.
Molecular Properties
| Compound Name | CID 136814507 |
| PubChem CID | 136814507 |
| Molecular Formula | C13H34OSi4 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | — |
| SMILES | CC(C)O[Si]C([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C13H34OSi4/c1-12(2)14-15-13(16(3,4)5,17(6,7)8)18(9,10)11/h12H,1-11H3 |
| InChIKey | GVUOPGDATRXOEH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 136814507 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136814507?
The IUPAC name of CID 136814507 (CID 136814507) is not available.
What is the SMILES notation for CID 136814507?
The canonical SMILES for CID 136814507 is CC(C)O[Si]C([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of CID 136814507?
The InChIKey is GVUOPGDATRXOEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H34OSi4/c1-12(2)14-15-13(16(3,4)5,17(6,7)8)18(9,10)11/h12H,1-11H3.
What are the key properties of CID 136814507?
CID 136814507 has a molecular weight of 318.76 g/mol, XLogP of 4.82, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136814507 is sourced from PubChem (CID 136814507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).