About CID 136815144
CID 136815144 (PubChem CID 136815144) has the molecular formula C2H3SSi
and a molecular weight of 87.20 g/mol.
Molecular Properties
| Compound Name | CID 136815144 |
| PubChem CID | 136815144 |
| Molecular Formula | C2H3SSi |
| Molecular Weight | 87.20 g/mol |
| Exact Mass | 86.97 |
| IUPAC Name | — |
| SMILES | C=C([Si])S |
| InChI | InChI=1S/C2H3SSi/c1-2(3)4/h3H,1H2 |
| InChIKey | GJJKHGLSVDAOON-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 87.20 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 136815144 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136815144?
The IUPAC name of CID 136815144 (CID 136815144) is not available.
What is the SMILES notation for CID 136815144?
The canonical SMILES for CID 136815144 is C=C([Si])S.
What is the InChIKey of CID 136815144?
The InChIKey is GJJKHGLSVDAOON-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3SSi/c1-2(3)4/h3H,1H2.
What are the key properties of CID 136815144?
CID 136815144 has a molecular weight of 87.20 g/mol, XLogP of 0.56, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136815144 is sourced from PubChem (CID 136815144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).