About (3-hydroxy-4,6-dimethylidenecyclohex-2-en-1-ylidene)oxidanium
(3-hydroxy-4,6-dimethylidenecyclohex-2-en-1-ylidene)oxidanium (PubChem CID 136815195) has the molecular formula C8H9O2+
and a molecular weight of 137.16 g/mol. Its IUPAC name is (3-hydroxy-4,6-dimethylidenecyclohex-2-en-1-ylidene)oxidanium.
Molecular Properties
| Compound Name | (3-hydroxy-4,6-dimethylidenecyclohex-2-en-1-ylidene)oxidanium |
| PubChem CID | 136815195 |
| Molecular Formula | C8H9O2+ |
| Molecular Weight | 137.16 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | (3-hydroxy-4,6-dimethylidenecyclohex-2-en-1-ylidene)oxidanium |
| SMILES | [H]/[O+]=C1\C=C(O)C(=C)CC1=C |
| InChI | InChI=1S/C8H8O2/c1-5-3-6(2)8(10)4-7(5)9/h4,9H,1-3H2/p+1 |
| InChIKey | YPAYXOICOUYKLQ-UHFFFAOYSA-O |
| XLogP | 1.49 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.16 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxy-4,6-dimethylidenecyclohex-2-en-1-ylidene)oxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-4,6-dimethylidenecyclohex-2-en-1-ylidene)oxidanium?
The IUPAC name of (3-hydroxy-4,6-dimethylidenecyclohex-2-en-1-ylidene)oxidanium (CID 136815195) is (3-hydroxy-4,6-dimethylidenecyclohex-2-en-1-ylidene)oxidanium.
What is the SMILES notation for (3-hydroxy-4,6-dimethylidenecyclohex-2-en-1-ylidene)oxidanium?
The canonical SMILES for (3-hydroxy-4,6-dimethylidenecyclohex-2-en-1-ylidene)oxidanium is [H]/[O+]=C1\C=C(O)C(=C)CC1=C.
What is the InChIKey of (3-hydroxy-4,6-dimethylidenecyclohex-2-en-1-ylidene)oxidanium?
The InChIKey is YPAYXOICOUYKLQ-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H8O2/c1-5-3-6(2)8(10)4-7(5)9/h4,9H,1-3H2/p+1.
What are the key properties of (3-hydroxy-4,6-dimethylidenecyclohex-2-en-1-ylidene)oxidanium?
(3-hydroxy-4,6-dimethylidenecyclohex-2-en-1-ylidene)oxidanium has a molecular weight of 137.16 g/mol, XLogP of 1.49, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-4,6-dimethylidenecyclohex-2-en-1-ylidene)oxidanium is sourced from PubChem (CID 136815195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).