C21H31F2N5 — CID 136815435
(5S,7R)-7-(difluoromethyl)-5-[(3S)-1-[[(1R,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]piperidin-3-yl]-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 136815435) has the molecular formula C21H31F2N5 and a molecular weight of 391.51 g/mol. Its IUPAC name is (5S,7R)-7-(difluoromethyl)-5-[(3S)-1-[[(1R,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]piperidin-3-yl]-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | (5S,7R)-7-(difluoromethyl)-5-[(3S)-1-[[(1R,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]piperidin-3-yl]-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136815435 |
| Molecular Formula | C21H31F2N5 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | (5S,7R)-7-(difluoromethyl)-5-[(3S)-1-[[(1R,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]piperidin-3-yl]-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | CC1(C)[C@@H]2CC=C(CN3CCC[C@H]([C@@H]4C[C@H](C(F)F)n5ncnc5N4)C3)[C@@H]1C2 |
| InChI | InChI=1S/C21H31F2N5/c1-21(2)15-6-5-13(16(21)8-15)10-27-7-3-4-14(11-27)17-9-18(19(22)23)28-20(26-17)24-12-25-28/h5,12,14-19H,3-4,6-11H2,1-2H3,(H,24,25,26)/t14-,15+,16-,17-,18+/m0/s1 |
| InChIKey | NDJIUGRAAGKUEC-FLXSYLCISA-N |
| XLogP | 3.97 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|