C19H16INO3 — CID 1368156
1-[(2-hydroxyphenyl)iminomethyl]-3-iodo-6,7,8,9-tetrahydrodibenzofuran-2-ol (PubChem CID 1368156) has the molecular formula C19H16INO3 and a molecular weight of 433.25 g/mol. Its IUPAC name is 1-[(2-hydroxyphenyl)iminomethyl]-3-iodo-6,7,8,9-tetrahydrodibenzofuran-2-ol.
| Compound Name | 1-[(2-hydroxyphenyl)iminomethyl]-3-iodo-6,7,8,9-tetrahydrodibenzofuran-2-ol |
|---|---|
| PubChem CID | 1368156 |
| Molecular Formula | C19H16INO3 |
| Molecular Weight | 433.25 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | 1-[(2-hydroxyphenyl)iminomethyl]-3-iodo-6,7,8,9-tetrahydrodibenzofuran-2-ol |
| SMILES | Oc1ccccc1/N=C/c1c(O)c(I)cc2oc3c(c12)CCCC3 |
| InChI | InChI=1S/C19H16INO3/c20-13-9-17-18(11-5-1-4-8-16(11)24-17)12(19(13)23)10-21-14-6-2-3-7-15(14)22/h2-3,6-7,9-10,22-23H,1,4-5,8H2/b21-10+ |
| InChIKey | JQAMZXLFTSJLDV-UFFVCSGVSA-N |
| XLogP | 5.08 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.25 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|