C20H27N5O4 — CID 136816066
3-[2-[(10aR)-2,10a-dimethyl-4-oxo-5,6,6a,8,9,10-hexahydro-3H-pyrido[2,3-h]quinazolin-7-yl]-2-oxoethyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 136816066) has the molecular formula C20H27N5O4 and a molecular weight of 401.47 g/mol. Its IUPAC name is 3-[2-[(10aR)-2,10a-dimethyl-4-oxo-5,6,6a,8,9,10-hexahydro-3H-pyrido[2,3-h]quinazolin-7-yl]-2-oxoethyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[2-[(10aR)-2,10a-dimethyl-4-oxo-5,6,6a,8,9,10-hexahydro-3H-pyrido[2,3-h]quinazolin-7-yl]-2-oxoethyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 136816066 |
| Molecular Formula | C20H27N5O4 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 3-[2-[(10aR)-2,10a-dimethyl-4-oxo-5,6,6a,8,9,10-hexahydro-3H-pyrido[2,3-h]quinazolin-7-yl]-2-oxoethyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | Cc1nc2c(c(=O)[nH]1)CCC1N(C(=O)CN3C(=O)NC(C)(C)C3=O)CCC[C@@]21C |
| InChI | InChI=1S/C20H27N5O4/c1-11-21-15-12(16(27)22-11)6-7-13-20(15,4)8-5-9-24(13)14(26)10-25-17(28)19(2,3)23-18(25)29/h13H,5-10H2,1-4H3,(H,23,29)(H,21,22,27)/t13?,20-/m1/s1 |
| InChIKey | AGUYBZLBGZUZBN-LCNBYPMKSA-N |
| XLogP | 0.60 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|