C19H20N2O4S — CID 136816464
1-[[5-(4-methoxyphenyl)-1,1-dioxo-4-phenyl-1,2-thiazol-3-ylidene]amino]propan-2-ol (PubChem CID 136816464) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is 1-[[5-(4-methoxyphenyl)-1,1-dioxo-4-phenyl-1,2-thiazol-3-ylidene]amino]propan-2-ol.
| Compound Name | 1-[[5-(4-methoxyphenyl)-1,1-dioxo-4-phenyl-1,2-thiazol-3-ylidene]amino]propan-2-ol |
|---|---|
| PubChem CID | 136816464 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 1-[[5-(4-methoxyphenyl)-1,1-dioxo-4-phenyl-1,2-thiazol-3-ylidene]amino]propan-2-ol |
| SMILES | COc1ccc(C2=C(c3ccccc3)/C(=N/CC(C)O)NS2(=O)=O)cc1 |
| InChI | InChI=1S/C19H20N2O4S/c1-13(22)12-20-19-17(14-6-4-3-5-7-14)18(26(23,24)21-19)15-8-10-16(25-2)11-9-15/h3-11,13,22H,12H2,1-2H3,(H,20,21) |
| InChIKey | ACSJRZAKZSQFCF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|