C15H21N3O2 — CID 136816511
(6aS,9aR)-2-methyl-8-(2-methylpropanoyl)-5,6,6a,7,9,9a-hexahydro-3H-pyrrolo[3,4-h]quinazolin-4-one (PubChem CID 136816511) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is (6aS,9aR)-2-methyl-8-(2-methylpropanoyl)-5,6,6a,7,9,9a-hexahydro-3H-pyrrolo[3,4-h]quinazolin-4-one.
| Compound Name | (6aS,9aR)-2-methyl-8-(2-methylpropanoyl)-5,6,6a,7,9,9a-hexahydro-3H-pyrrolo[3,4-h]quinazolin-4-one |
|---|---|
| PubChem CID | 136816511 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | (6aS,9aR)-2-methyl-8-(2-methylpropanoyl)-5,6,6a,7,9,9a-hexahydro-3H-pyrrolo[3,4-h]quinazolin-4-one |
| SMILES | Cc1nc2c(c(=O)[nH]1)CC[C@@H]1CN(C(=O)C(C)C)C[C@H]21 |
| InChI | InChI=1S/C15H21N3O2/c1-8(2)15(20)18-6-10-4-5-11-13(12(10)7-18)16-9(3)17-14(11)19/h8,10,12H,4-7H2,1-3H3,(H,16,17,19)/t10-,12+/m1/s1 |
| InChIKey | OBLLUWGFTFABMX-PWSUYJOCSA-N |
| XLogP | 1.22 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |