C25H16Cl2N4O5 — CID 136816964
2-[(3R)-3-(2,4-dichlorophenyl)-2-(2,4-dinitrophenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-ol (PubChem CID 136816964) has the molecular formula C25H16Cl2N4O5 and a molecular weight of 523.33 g/mol. Its IUPAC name is 2-[(3R)-3-(2,4-dichlorophenyl)-2-(2,4-dinitrophenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-ol.
| Compound Name | 2-[(3R)-3-(2,4-dichlorophenyl)-2-(2,4-dinitrophenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-ol |
|---|---|
| PubChem CID | 136816964 |
| Molecular Formula | C25H16Cl2N4O5 |
| Molecular Weight | 523.33 g/mol |
| Exact Mass | 522.05 |
| IUPAC Name | 2-[(3R)-3-(2,4-dichlorophenyl)-2-(2,4-dinitrophenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-ol |
| SMILES | O=[N+]([O-])c1ccc(N2N=C(c3ccc4ccccc4c3O)C[C@@H]2c2ccc(Cl)cc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H16Cl2N4O5/c26-15-6-9-18(20(27)11-15)23-13-21(19-8-5-14-3-1-2-4-17(14)25(19)32)28-29(23)22-10-7-16(30(33)34)12-24(22)31(35)36/h1-12,23,32H,13H2/t23-/m1/s1 |
| InChIKey | XIPFDLFRGVWTDZ-HSZRJFAPSA-N |
| XLogP | 7.02 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.33 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|