C11H21N3OS — CID 136817723
3-[(4,4-dimethyl-1,3-thiazolidin-2-ylidene)amino]-N,2,2-trimethylpropanamide (PubChem CID 136817723) has the molecular formula C11H21N3OS and a molecular weight of 243.38 g/mol. Its IUPAC name is 3-[(4,4-dimethyl-1,3-thiazolidin-2-ylidene)amino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[(4,4-dimethyl-1,3-thiazolidin-2-ylidene)amino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 136817723 |
| Molecular Formula | C11H21N3OS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 3-[(4,4-dimethyl-1,3-thiazolidin-2-ylidene)amino]-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)C/N=C1/NC(C)(C)CS1 |
| InChI | InChI=1S/C11H21N3OS/c1-10(2,8(15)12-5)6-13-9-14-11(3,4)7-16-9/h6-7H2,1-5H3,(H,12,15)(H,13,14) |
| InChIKey | VNNTVGODZCBJTP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|