C8H13N3O2 — CID 136818890
4-(ethylamino)-2-(methoxymethyl)-1H-pyrimidin-6-one (PubChem CID 136818890) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 4-(ethylamino)-2-(methoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 4-(ethylamino)-2-(methoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136818890 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 4-(ethylamino)-2-(methoxymethyl)-1H-pyrimidin-6-one |
| SMILES | CCNc1cc(=O)[nH]c(COC)n1 |
| InChI | InChI=1S/C8H13N3O2/c1-3-9-6-4-8(12)11-7(10-6)5-13-2/h4H,3,5H2,1-2H3,(H2,9,10,11,12) |
| InChIKey | QVLAGJCTKHZOBP-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |