About 6,9-dimethyl-7H-pyrrolo[3,4-f][1,10]phenanthroline
6,9-dimethyl-7H-pyrrolo[3,4-f][1,10]phenanthroline (PubChem CID 136819198) has the molecular formula C16H13N3
and a molecular weight of 247.30 g/mol. Its IUPAC name is 6,9-dimethyl-7H-pyrrolo[3,4-f][1,10]phenanthroline.
Molecular Properties
| Compound Name | 6,9-dimethyl-7H-pyrrolo[3,4-f][1,10]phenanthroline |
| PubChem CID | 136819198 |
| Molecular Formula | C16H13N3 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 6,9-dimethyl-7H-pyrrolo[3,4-f][1,10]phenanthroline |
| SMILES | Cc1ccc2c3cncc3c3ccc(C)[nH]c3c2n1 |
| InChI | InChI=1S/C16H13N3/c1-9-3-5-11-13-7-17-8-14(13)12-6-4-10(2)19-16(12)15(11)18-9/h3-8,18H,1-2H3 |
| InChIKey | HKDJBIGGYMYRBA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 6,9-dimethyl-7H-pyrrolo[3,4-f][1,10]phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,9-dimethyl-7H-pyrrolo[3,4-f][1,10]phenanthroline?
The IUPAC name of 6,9-dimethyl-7H-pyrrolo[3,4-f][1,10]phenanthroline (CID 136819198) is 6,9-dimethyl-7H-pyrrolo[3,4-f][1,10]phenanthroline.
What is the SMILES notation for 6,9-dimethyl-7H-pyrrolo[3,4-f][1,10]phenanthroline?
The canonical SMILES for 6,9-dimethyl-7H-pyrrolo[3,4-f][1,10]phenanthroline is Cc1ccc2c3cncc3c3ccc(C)[nH]c3c2n1.
What is the InChIKey of 6,9-dimethyl-7H-pyrrolo[3,4-f][1,10]phenanthroline?
The InChIKey is HKDJBIGGYMYRBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3/c1-9-3-5-11-13-7-17-8-14(13)12-6-4-10(2)19-16(12)15(11)18-9/h3-8,18H,1-2H3.
What are the key properties of 6,9-dimethyl-7H-pyrrolo[3,4-f][1,10]phenanthroline?
6,9-dimethyl-7H-pyrrolo[3,4-f][1,10]phenanthroline has a molecular weight of 247.30 g/mol, XLogP of 3.88, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,9-dimethyl-7H-pyrrolo[3,4-f][1,10]phenanthroline is sourced from PubChem (CID 136819198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).