C11H15F4N3O — CID 136819380
2,4-dimethyl-5-[1-(2,2,3,3-tetrafluoropropylamino)ethyl]-1H-pyrimidin-6-one (PubChem CID 136819380) has the molecular formula C11H15F4N3O and a molecular weight of 281.25 g/mol. Its IUPAC name is 2,4-dimethyl-5-[1-(2,2,3,3-tetrafluoropropylamino)ethyl]-1H-pyrimidin-6-one.
| Compound Name | 2,4-dimethyl-5-[1-(2,2,3,3-tetrafluoropropylamino)ethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136819380 |
| Molecular Formula | C11H15F4N3O |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2,4-dimethyl-5-[1-(2,2,3,3-tetrafluoropropylamino)ethyl]-1H-pyrimidin-6-one |
| SMILES | Cc1nc(C)c(C(C)NCC(F)(F)C(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C11H15F4N3O/c1-5(16-4-11(14,15)10(12)13)8-6(2)17-7(3)18-9(8)19/h5,10,16H,4H2,1-3H3,(H,17,18,19) |
| InChIKey | ZMDFQXQIBNHWNO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|