C8H9F4N3O2 — CID 136819405
5-methoxy-4-(2,2,3,3-tetrafluoropropylamino)-1H-pyrimidin-6-one (PubChem CID 136819405) has the molecular formula C8H9F4N3O2 and a molecular weight of 255.17 g/mol. Its IUPAC name is 5-methoxy-4-(2,2,3,3-tetrafluoropropylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-methoxy-4-(2,2,3,3-tetrafluoropropylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136819405 |
| Molecular Formula | C8H9F4N3O2 |
| Molecular Weight | 255.17 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 5-methoxy-4-(2,2,3,3-tetrafluoropropylamino)-1H-pyrimidin-6-one |
| SMILES | COc1c(NCC(F)(F)C(F)F)nc[nH]c1=O |
| InChI | InChI=1S/C8H9F4N3O2/c1-17-4-5(14-3-15-6(4)16)13-2-8(11,12)7(9)10/h3,7H,2H2,1H3,(H2,13,14,15,16) |
| InChIKey | XRRATCHYAIBKQT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.17 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|