C7H8F4N4O — CID 136819406
5-amino-4-(2,2,3,3-tetrafluoropropylamino)-1H-pyrimidin-6-one (PubChem CID 136819406) has the molecular formula C7H8F4N4O and a molecular weight of 240.16 g/mol. Its IUPAC name is 5-amino-4-(2,2,3,3-tetrafluoropropylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-(2,2,3,3-tetrafluoropropylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136819406 |
| Molecular Formula | C7H8F4N4O |
| Molecular Weight | 240.16 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 5-amino-4-(2,2,3,3-tetrafluoropropylamino)-1H-pyrimidin-6-one |
| SMILES | Nc1c(NCC(F)(F)C(F)F)nc[nH]c1=O |
| InChI | InChI=1S/C7H8F4N4O/c8-6(9)7(10,11)1-13-4-3(12)5(16)15-2-14-4/h2,6H,1,12H2,(H2,13,14,15,16) |
| InChIKey | MLRVVAFNAAQGDD-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.16 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|