C13H22N4O2 — CID 136819582
4-[[4-(aminomethyl)oxan-4-yl]amino]-2-propan-2-yl-1H-pyrimidin-6-one (PubChem CID 136819582) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 4-[[4-(aminomethyl)oxan-4-yl]amino]-2-propan-2-yl-1H-pyrimidin-6-one.
| Compound Name | 4-[[4-(aminomethyl)oxan-4-yl]amino]-2-propan-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136819582 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 4-[[4-(aminomethyl)oxan-4-yl]amino]-2-propan-2-yl-1H-pyrimidin-6-one |
| SMILES | CC(C)c1nc(NC2(CN)CCOCC2)cc(=O)[nH]1 |
| InChI | InChI=1S/C13H22N4O2/c1-9(2)12-15-10(7-11(18)16-12)17-13(8-14)3-5-19-6-4-13/h7,9H,3-6,8,14H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | KPSZTMLQCCLLTI-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |