C19H21N5O — CID 136820682
6-[[[(1S)-2,3-dihydro-1H-inden-1-yl]-prop-2-enylamino]methyl]-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 136820682) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is 6-[[[(1S)-2,3-dihydro-1H-inden-1-yl]-prop-2-enylamino]methyl]-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-[[[(1S)-2,3-dihydro-1H-inden-1-yl]-prop-2-enylamino]methyl]-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136820682 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 6-[[[(1S)-2,3-dihydro-1H-inden-1-yl]-prop-2-enylamino]methyl]-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | C=CCN(Cc1nc2c(cnn2C)c(=O)[nH]1)[C@H]1CCc2ccccc21 |
| InChI | InChI=1S/C19H21N5O/c1-3-10-24(16-9-8-13-6-4-5-7-14(13)16)12-17-21-18-15(19(25)22-17)11-20-23(18)2/h3-7,11,16H,1,8-10,12H2,2H3,(H,21,22,25)/t16-/m0/s1 |
| InChIKey | SBSSFPVLODEGHZ-INIZCTEOSA-N |
| XLogP | 2.33 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|