C17H24N4O4 — CID 136821068
2-morpholin-4-yl-4-[(3R)-1-[(3R)-oxolane-3-carbonyl]pyrrolidin-3-yl]-1H-pyrimidin-6-one (PubChem CID 136821068) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-morpholin-4-yl-4-[(3R)-1-[(3R)-oxolane-3-carbonyl]pyrrolidin-3-yl]-1H-pyrimidin-6-one.
| Compound Name | 2-morpholin-4-yl-4-[(3R)-1-[(3R)-oxolane-3-carbonyl]pyrrolidin-3-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136821068 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 2-morpholin-4-yl-4-[(3R)-1-[(3R)-oxolane-3-carbonyl]pyrrolidin-3-yl]-1H-pyrimidin-6-one |
| SMILES | O=C([C@@H]1CCOC1)N1CC[C@@H](c2cc(=O)[nH]c(N3CCOCC3)n2)C1 |
| InChI | InChI=1S/C17H24N4O4/c22-15-9-14(18-17(19-15)20-4-7-24-8-5-20)12-1-3-21(10-12)16(23)13-2-6-25-11-13/h9,12-13H,1-8,10-11H2,(H,18,19,22)/t12-,13-/m1/s1 |
| InChIKey | XSGQNXNWNBGYLY-CHWSQXEVSA-N |
| XLogP | -0.04 |
| TPSA | 87.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |