About 6-amino-7-[(1-methyl-1,2,4-triazol-3-yl)oxy]-3H-quinazolin-4-one
6-amino-7-[(1-methyl-1,2,4-triazol-3-yl)oxy]-3H-quinazolin-4-one (PubChem CID 136822002) has the molecular formula C11H10N6O2
and a molecular weight of 258.24 g/mol. Its IUPAC name is 6-amino-7-[(1-methyl-1,2,4-triazol-3-yl)oxy]-3H-quinazolin-4-one.
Molecular Properties
| Compound Name | 6-amino-7-[(1-methyl-1,2,4-triazol-3-yl)oxy]-3H-quinazolin-4-one |
| PubChem CID | 136822002 |
| Molecular Formula | C11H10N6O2 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 6-amino-7-[(1-methyl-1,2,4-triazol-3-yl)oxy]-3H-quinazolin-4-one |
| SMILES | Cn1cnc(Oc2cc3nc[nH]c(=O)c3cc2N)n1 |
| InChI | InChI=1S/C11H10N6O2/c1-17-5-15-11(16-17)19-9-3-8-6(2-7(9)12)10(18)14-4-13-8/h2-5H,12H2,1H3,(H,13,14,18) |
| InChIKey | NWBDEXHXPMRERO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-7-[(1-methyl-1,2,4-triazol-3-yl)oxy]-3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-7-[(1-methyl-1,2,4-triazol-3-yl)oxy]-3H-quinazolin-4-one?
The IUPAC name of 6-amino-7-[(1-methyl-1,2,4-triazol-3-yl)oxy]-3H-quinazolin-4-one (CID 136822002) is 6-amino-7-[(1-methyl-1,2,4-triazol-3-yl)oxy]-3H-quinazolin-4-one.
What is the SMILES notation for 6-amino-7-[(1-methyl-1,2,4-triazol-3-yl)oxy]-3H-quinazolin-4-one?
The canonical SMILES for 6-amino-7-[(1-methyl-1,2,4-triazol-3-yl)oxy]-3H-quinazolin-4-one is Cn1cnc(Oc2cc3nc[nH]c(=O)c3cc2N)n1.
What is the InChIKey of 6-amino-7-[(1-methyl-1,2,4-triazol-3-yl)oxy]-3H-quinazolin-4-one?
The InChIKey is NWBDEXHXPMRERO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N6O2/c1-17-5-15-11(16-17)19-9-3-8-6(2-7(9)12)10(18)14-4-13-8/h2-5H,12H2,1H3,(H,13,14,18).
What are the key properties of 6-amino-7-[(1-methyl-1,2,4-triazol-3-yl)oxy]-3H-quinazolin-4-one?
6-amino-7-[(1-methyl-1,2,4-triazol-3-yl)oxy]-3H-quinazolin-4-one has a molecular weight of 258.24 g/mol, XLogP of 0.43, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-7-[(1-methyl-1,2,4-triazol-3-yl)oxy]-3H-quinazolin-4-one is sourced from PubChem (CID 136822002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).