C14H23N3O2 — CID 136822017
2-ethyl-4-(2,2,6,6-tetramethylmorpholin-4-yl)-1H-pyrimidin-6-one (PubChem CID 136822017) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-ethyl-4-(2,2,6,6-tetramethylmorpholin-4-yl)-1H-pyrimidin-6-one.
| Compound Name | 2-ethyl-4-(2,2,6,6-tetramethylmorpholin-4-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136822017 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 2-ethyl-4-(2,2,6,6-tetramethylmorpholin-4-yl)-1H-pyrimidin-6-one |
| SMILES | CCc1nc(N2CC(C)(C)OC(C)(C)C2)cc(=O)[nH]1 |
| InChI | InChI=1S/C14H23N3O2/c1-6-10-15-11(7-12(18)16-10)17-8-13(2,3)19-14(4,5)9-17/h7H,6,8-9H2,1-5H3,(H,15,16,18) |
| InChIKey | OTPXSECVBDNUBV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |