C12H10Cl3N3OS — CID 136822019
4-propyl-2-[(3,5,6-trichloro-2-pyridinyl)sulfanyl]-1H-pyrimidin-6-one (PubChem CID 136822019) has the molecular formula C12H10Cl3N3OS and a molecular weight of 350.66 g/mol. Its IUPAC name is 4-propyl-2-[(3,5,6-trichloro-2-pyridinyl)sulfanyl]-1H-pyrimidin-6-one.
| Compound Name | 4-propyl-2-[(3,5,6-trichloro-2-pyridinyl)sulfanyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136822019 |
| Molecular Formula | C12H10Cl3N3OS |
| Molecular Weight | 350.66 g/mol |
| Exact Mass | 348.96 |
| IUPAC Name | 4-propyl-2-[(3,5,6-trichloro-2-pyridinyl)sulfanyl]-1H-pyrimidin-6-one |
| SMILES | CCCc1cc(=O)[nH]c(Sc2nc(Cl)c(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C12H10Cl3N3OS/c1-2-3-6-4-9(19)17-12(16-6)20-11-8(14)5-7(13)10(15)18-11/h4-5H,2-3H2,1H3,(H,16,17,19) |
| InChIKey | YQSRJQICVQVXEP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.66 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|