C29H41BO12- — CID 136823583
CID 136823583 (PubChem CID 136823583) has the molecular formula C29H41BO12- and a molecular weight of 592.45 g/mol.
| Compound Name | CID 136823583 |
|---|---|
| PubChem CID | 136823583 |
| Molecular Formula | C29H41BO12- |
| Molecular Weight | 592.45 g/mol |
| Exact Mass | 592.27 |
| IUPAC Name | — |
| SMILES | C[C@@H]1O[C@@H](O[C@H]2C[C@H]3O[B-]4OC[C@]35[C@@H]3[C@@H](CC[C@]5(O)C2)[C@@]2(O)CC[C@H](C5=CC(=O)OC5)[C@@]2(C)C[C@H]3O4)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C29H41BO12/c1-13-22(32)23(33)24(34)25(39-13)40-15-8-19-28-12-38-30(42-19)41-18-10-26(2)16(14-7-20(31)37-11-14)4-6-29(26,36)17(21(18)28)3-5-27(28,35)9-15/h7,13,15-19,21-25,32-36H,3-6,8-12H2,1-2H3/q-1/t13-,15-,16+,17+,18+,19+,21+,22-,23+,24+,25-,26+,27-,28+,29-/m0/s1 |
| InChIKey | BVGCKBLFXPXKNV-HBYQJFLCSA-N |
| XLogP | -0.43 |
| TPSA | 173.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.45 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|