C29H29N5O5 — CID 136824119
(7R)-N-(2,4-dimethoxyphenyl)-7-(3-methoxy-4-phenylmethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 136824119) has the molecular formula C29H29N5O5 and a molecular weight of 527.58 g/mol. Its IUPAC name is (7R)-N-(2,4-dimethoxyphenyl)-7-(3-methoxy-4-phenylmethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7R)-N-(2,4-dimethoxyphenyl)-7-(3-methoxy-4-phenylmethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 136824119 |
| Molecular Formula | C29H29N5O5 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | (7R)-N-(2,4-dimethoxyphenyl)-7-(3-methoxy-4-phenylmethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccc(NC(=O)C2=C(C)Nc3ncnn3[C@@H]2c2ccc(OCc3ccccc3)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C29H29N5O5/c1-18-26(28(35)33-22-12-11-21(36-2)15-24(22)37-3)27(34-29(32-18)30-17-31-34)20-10-13-23(25(14-20)38-4)39-16-19-8-6-5-7-9-19/h5-15,17,27H,16H2,1-4H3,(H,33,35)(H,30,31,32)/t27-/m1/s1 |
| InChIKey | ONNJHEIZZAWBGH-HHHXNRCGSA-N |
| XLogP | 4.81 |
| TPSA | 108.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |