C24H31BrN4O3 — CID 136824292
[(1R,2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] (7R)-7-(5-bromo-2-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 136824292) has the molecular formula C24H31BrN4O3 and a molecular weight of 503.44 g/mol. Its IUPAC name is [(1R,2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] (7R)-7-(5-bromo-2-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | [(1R,2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] (7R)-7-(5-bromo-2-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 136824292 |
| Molecular Formula | C24H31BrN4O3 |
| Molecular Weight | 503.44 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | [(1R,2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] (7R)-7-(5-bromo-2-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | COc1ccc(Br)cc1[C@@H]1C(C(=O)O[C@@H]2C[C@@H](C)CC[C@H]2C(C)C)=C(C)Nc2ncnn21 |
| InChI | InChI=1S/C24H31BrN4O3/c1-13(2)17-8-6-14(3)10-20(17)32-23(30)21-15(4)28-24-26-12-27-29(24)22(21)18-11-16(25)7-9-19(18)31-5/h7,9,11-14,17,20,22H,6,8,10H2,1-5H3,(H,26,27,28)/t14-,17-,20+,22+/m0/s1 |
| InChIKey | RGEHWBRWIPURQI-AWSYCSROSA-N |
| XLogP | 5.34 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |