C22H23N7O2 — CID 136825352
(4S)-4-(4-butoxyphenyl)-3-methyl-1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 136825352) has the molecular formula C22H23N7O2 and a molecular weight of 417.47 g/mol. Its IUPAC name is (4S)-4-(4-butoxyphenyl)-3-methyl-1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one.
| Compound Name | (4S)-4-(4-butoxyphenyl)-3-methyl-1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 136825352 |
| Molecular Formula | C22H23N7O2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (4S)-4-(4-butoxyphenyl)-3-methyl-1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | CCCCOc1ccc([C@@H]2CC(=O)Nc3c2c(C)nn3-c2ccc3nncn3n2)cc1 |
| InChI | InChI=1S/C22H23N7O2/c1-3-4-11-31-16-7-5-15(6-8-16)17-12-20(30)24-22-21(17)14(2)26-29(22)19-10-9-18-25-23-13-28(18)27-19/h5-10,13,17H,3-4,11-12H2,1-2H3,(H,24,30)/t17-/m0/s1 |
| InChIKey | CQTLJGDUAUUETA-KRWDZBQOSA-N |
| XLogP | 3.27 |
| TPSA | 99.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|