C37H14F12N4 — CID 136825567
5,10,15-tris(2,3,5,6-tetrafluorophenyl)-22,23-dihydro-21H-corrin (PubChem CID 136825567) has the molecular formula C37H14F12N4 and a molecular weight of 742.52 g/mol. Its IUPAC name is 5,10,15-tris(2,3,5,6-tetrafluorophenyl)-22,23-dihydro-21H-corrin.
| Compound Name | 5,10,15-tris(2,3,5,6-tetrafluorophenyl)-22,23-dihydro-21H-corrin |
|---|---|
| PubChem CID | 136825567 |
| Molecular Formula | C37H14F12N4 |
| Molecular Weight | 742.52 g/mol |
| Exact Mass | 742.10 |
| IUPAC Name | 5,10,15-tris(2,3,5,6-tetrafluorophenyl)-22,23-dihydro-21H-corrin |
| SMILES | Fc1cc(F)c(F)c(-c2c3nc(c4ccc([nH]4)c(-c4c(F)c(F)cc(F)c4F)c4ccc([nH]4)c(-c4c(F)c(F)cc(F)c4F)c4ccc2[nH]4)C=C3)c1F |
| InChI | InChI=1S/C37H14F12N4/c38-12-9-13(39)33(45)29(32(12)44)26-20-3-1-18(50-20)19-2-4-21(51-19)27(30-34(46)14(40)10-15(41)35(30)47)23-6-8-25(53-23)28(24-7-5-22(26)52-24)31-36(48)16(42)11-17(43)37(31)49/h1-11,50,52-53H/b19-18-,26-20+,26-22+,27-21+,27-23+,28-24+,28-25+ |
| InChIKey | BUOVNZBVLBVVSQ-VRNXPLIMSA-N |
| XLogP | 11.37 |
| TPSA | 60.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.52 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|