C14H19N5OS — CID 136825905
4-methyl-2-[5-[(2-methylpropylamino)methyl]pyrimidin-2-yl]sulfanyl-1H-pyrimidin-6-one (PubChem CID 136825905) has the molecular formula C14H19N5OS and a molecular weight of 305.41 g/mol. Its IUPAC name is 4-methyl-2-[5-[(2-methylpropylamino)methyl]pyrimidin-2-yl]sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 4-methyl-2-[5-[(2-methylpropylamino)methyl]pyrimidin-2-yl]sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136825905 |
| Molecular Formula | C14H19N5OS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 4-methyl-2-[5-[(2-methylpropylamino)methyl]pyrimidin-2-yl]sulfanyl-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c(Sc2ncc(CNCC(C)C)cn2)n1 |
| InChI | InChI=1S/C14H19N5OS/c1-9(2)5-15-6-11-7-16-13(17-8-11)21-14-18-10(3)4-12(20)19-14/h4,7-9,15H,5-6H2,1-3H3,(H,18,19,20) |
| InChIKey | UBGUFCXVEVCYLF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |