C14H16N6O2 — CID 136826339
N-[(E)-1H-pyrrol-2-ylmethylideneamino]-N'-[(Z)-1H-pyrrol-2-ylmethylideneamino]butanediamide (PubChem CID 136826339) has the molecular formula C14H16N6O2 and a molecular weight of 300.32 g/mol. Its IUPAC name is N-[(E)-1H-pyrrol-2-ylmethylideneamino]-N'-[(Z)-1H-pyrrol-2-ylmethylideneamino]butanediamide.
| Compound Name | N-[(E)-1H-pyrrol-2-ylmethylideneamino]-N'-[(Z)-1H-pyrrol-2-ylmethylideneamino]butanediamide |
|---|---|
| PubChem CID | 136826339 |
| Molecular Formula | C14H16N6O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | N-[(E)-1H-pyrrol-2-ylmethylideneamino]-N'-[(Z)-1H-pyrrol-2-ylmethylideneamino]butanediamide |
| SMILES | O=C(CCC(=O)N/N=C/c1ccc[nH]1)N/N=C\c1ccc[nH]1 |
| InChI | InChI=1S/C14H16N6O2/c21-13(19-17-9-11-3-1-7-15-11)5-6-14(22)20-18-10-12-4-2-8-16-12/h1-4,7-10,15-16H,5-6H2,(H,19,21)(H,20,22)/b17-9-,18-10+ |
| InChIKey | XYTSLSHKEOZPMM-BUOZRGFLSA-N |
| XLogP | 0.72 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|