C24H20N4O4 — CID 136827880
(9R)-9-(2-hydroxyphenyl)-3-(2-methoxyanilino)-2,8,9,10-tetrahydropyrimido[4,5-c]isoquinoline-1,7-dione (PubChem CID 136827880) has the molecular formula C24H20N4O4 and a molecular weight of 428.45 g/mol. Its IUPAC name is (9R)-9-(2-hydroxyphenyl)-3-(2-methoxyanilino)-2,8,9,10-tetrahydropyrimido[4,5-c]isoquinoline-1,7-dione.
| Compound Name | (9R)-9-(2-hydroxyphenyl)-3-(2-methoxyanilino)-2,8,9,10-tetrahydropyrimido[4,5-c]isoquinoline-1,7-dione |
|---|---|
| PubChem CID | 136827880 |
| Molecular Formula | C24H20N4O4 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | (9R)-9-(2-hydroxyphenyl)-3-(2-methoxyanilino)-2,8,9,10-tetrahydropyrimido[4,5-c]isoquinoline-1,7-dione |
| SMILES | COc1ccccc1Nc1nc2ncc3c(c2c(=O)[nH]1)C[C@@H](c1ccccc1O)CC3=O |
| InChI | InChI=1S/C24H20N4O4/c1-32-20-9-5-3-7-17(20)26-24-27-22-21(23(31)28-24)15-10-13(11-19(30)16(15)12-25-22)14-6-2-4-8-18(14)29/h2-9,12-13,29H,10-11H2,1H3,(H2,25,26,27,28,31)/t13-/m1/s1 |
| InChIKey | XXOYFPRYCSAEGB-CYBMUJFWSA-N |
| XLogP | 3.69 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |