C14H16N4O4 — CID 136828033
N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-2-[(4R)-3-methyl-5-oxo-1,4-dihydropyrazol-4-yl]acetamide (PubChem CID 136828033) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-2-[(4R)-3-methyl-5-oxo-1,4-dihydropyrazol-4-yl]acetamide.
| Compound Name | N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-2-[(4R)-3-methyl-5-oxo-1,4-dihydropyrazol-4-yl]acetamide |
|---|---|
| PubChem CID | 136828033 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-2-[(4R)-3-methyl-5-oxo-1,4-dihydropyrazol-4-yl]acetamide |
| SMILES | COc1cccc(/C=N\NC(=O)C[C@H]2C(=O)NN=C2C)c1O |
| InChI | InChI=1S/C14H16N4O4/c1-8-10(14(21)18-16-8)6-12(19)17-15-7-9-4-3-5-11(22-2)13(9)20/h3-5,7,10,20H,6H2,1-2H3,(H,17,19)(H,18,21)/b15-7-/t10-/m1/s1 |
| InChIKey | BKGJQOWUFHIBRQ-CBQSTYFFSA-N |
| XLogP | 0.36 |
| TPSA | 112.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|