C10H16N4O5S — CID 136828515
5-amino-2-methylsulfanyl-4-[[(2S,3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]amino]-1H-pyrimidin-6-one (PubChem CID 136828515) has the molecular formula C10H16N4O5S and a molecular weight of 304.33 g/mol. Its IUPAC name is 5-amino-2-methylsulfanyl-4-[[(2S,3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]amino]-1H-pyrimidin-6-one.
| Compound Name | 5-amino-2-methylsulfanyl-4-[[(2S,3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136828515 |
| Molecular Formula | C10H16N4O5S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 5-amino-2-methylsulfanyl-4-[[(2S,3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]amino]-1H-pyrimidin-6-one |
| SMILES | CSc1nc(N[C@H]2OC[C@@H](O)[C@@H](O)[C@@H]2O)c(N)c(=O)[nH]1 |
| InChI | InChI=1S/C10H16N4O5S/c1-20-10-13-7(4(11)8(18)14-10)12-9-6(17)5(16)3(15)2-19-9/h3,5-6,9,15-17H,2,11H2,1H3,(H2,12,13,14,18)/t3-,5-,6+,9+/m1/s1 |
| InChIKey | TZLFZCHHZJNLME-ICKFSKTQSA-N |
| XLogP | -2.08 |
| TPSA | 153.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |