C23H33N3O4 — CID 136828572
5-[N-[3-[(2R)-2-ethylhexoxy]propyl]-C-methylcarbonimidoyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione (PubChem CID 136828572) has the molecular formula C23H33N3O4 and a molecular weight of 415.53 g/mol. Its IUPAC name is 5-[N-[3-[(2R)-2-ethylhexoxy]propyl]-C-methylcarbonimidoyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione.
| Compound Name | 5-[N-[3-[(2R)-2-ethylhexoxy]propyl]-C-methylcarbonimidoyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 136828572 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 5-[N-[3-[(2R)-2-ethylhexoxy]propyl]-C-methylcarbonimidoyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione |
| SMILES | CCCC[C@@H](CC)COCCC/N=C(\C)c1c(O)n(-c2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H33N3O4/c1-4-6-11-18(5-2)16-30-15-10-14-24-17(3)20-21(27)25-23(29)26(22(20)28)19-12-8-7-9-13-19/h7-9,12-13,18,28H,4-6,10-11,14-16H2,1-3H3,(H,25,27,29)/b24-17+/t18-/m1/s1 |
| InChIKey | OLBRBXJKEFJAAG-ZDSQJECRSA-N |
| XLogP | 3.66 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|