C22H29N5O4 — CID 136828999
(3aR,7aR)-2-[3-oxo-3-(4-oxo-2-pyrrolidin-1-yl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-7-yl)propyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 136828999) has the molecular formula C22H29N5O4 and a molecular weight of 427.51 g/mol. Its IUPAC name is (3aR,7aR)-2-[3-oxo-3-(4-oxo-2-pyrrolidin-1-yl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-7-yl)propyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aR)-2-[3-oxo-3-(4-oxo-2-pyrrolidin-1-yl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-7-yl)propyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 136828999 |
| Molecular Formula | C22H29N5O4 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | (3aR,7aR)-2-[3-oxo-3-(4-oxo-2-pyrrolidin-1-yl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-7-yl)propyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | O=C(CCN1C(=O)[C@@H]2CCCC[C@H]2C1=O)N1CCc2c(nc(N3CCCC3)[nH]c2=O)C1 |
| InChI | InChI=1S/C22H29N5O4/c28-18(8-12-27-20(30)14-5-1-2-6-15(14)21(27)31)26-11-7-16-17(13-26)23-22(24-19(16)29)25-9-3-4-10-25/h14-15H,1-13H2,(H,23,24,29)/t14-,15-/m1/s1 |
| InChIKey | SUHNAWKPPRGFHU-HUUCEWRRSA-N |
| XLogP | 0.82 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|