C17H22N2O3 — CID 136829066
(1S,6R,7R)-N-[(Z)-1-(2,4-dihydroxyphenyl)ethylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide (PubChem CID 136829066) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is (1S,6R,7R)-N-[(Z)-1-(2,4-dihydroxyphenyl)ethylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide.
| Compound Name | (1S,6R,7R)-N-[(Z)-1-(2,4-dihydroxyphenyl)ethylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide |
|---|---|
| PubChem CID | 136829066 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | (1S,6R,7R)-N-[(Z)-1-(2,4-dihydroxyphenyl)ethylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide |
| SMILES | C/C(=N/NC(=O)[C@@H]1[C@H]2CCCC[C@@]21C)c1ccc(O)cc1O |
| InChI | InChI=1S/C17H22N2O3/c1-10(12-7-6-11(20)9-14(12)21)18-19-16(22)15-13-5-3-4-8-17(13,15)2/h6-7,9,13,15,20-21H,3-5,8H2,1-2H3,(H,19,22)/b18-10-/t13-,15+,17+/m1/s1 |
| InChIKey | UWZUWLWVQGMCKJ-XELFTKGBSA-N |
| XLogP | 2.76 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|