C14H27N3OS — CID 136830040
2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N,N-diethylpropanamide (PubChem CID 136830040) has the molecular formula C14H27N3OS and a molecular weight of 285.46 g/mol. Its IUPAC name is 2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N,N-diethylpropanamide.
| Compound Name | 2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 136830040 |
| Molecular Formula | C14H27N3OS |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)/N=C1/NC(CC)(CC)CS1 |
| InChI | InChI=1S/C14H27N3OS/c1-6-14(7-2)10-19-13(16-14)15-11(5)12(18)17(8-3)9-4/h11H,6-10H2,1-5H3,(H,15,16) |
| InChIKey | UORFZKXSHKPZCL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|