C8H11N — CID 136830170
(1R,2R,5R,6S)-5,6-dideuterio-2-methylcyclohex-3-ene-1-carbonitrile (PubChem CID 136830170) has the molecular formula C8H11N and a molecular weight of 123.20 g/mol. Its IUPAC name is (1R,2R,5R,6S)-5,6-dideuterio-2-methylcyclohex-3-ene-1-carbonitrile.
| Compound Name | (1R,2R,5R,6S)-5,6-dideuterio-2-methylcyclohex-3-ene-1-carbonitrile |
|---|---|
| PubChem CID | 136830170 |
| Molecular Formula | C8H11N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | (1R,2R,5R,6S)-5,6-dideuterio-2-methylcyclohex-3-ene-1-carbonitrile |
| SMILES | [2H][C@@H]1[C@@H](C#N)[C@H](C)C=C[C@@H]1[2H] |
| InChI | InChI=1S/C8H11N/c1-7-4-2-3-5-8(7)6-9/h2,4,7-8H,3,5H2,1H3/t7-,8+/m1/s1/i3D,5D/t3-,5-,7+,8-/m0 |
| InChIKey | QNBUNDFJTSPPAD-HTYNRITLSA-N |
| XLogP | 2.11 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|