C16H9Cl2N7OS — CID 136831399
(8S)-8-(2,4-dichlorophenyl)-10-thiophen-2-yl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one (PubChem CID 136831399) has the molecular formula C16H9Cl2N7OS and a molecular weight of 418.27 g/mol. Its IUPAC name is (8S)-8-(2,4-dichlorophenyl)-10-thiophen-2-yl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one.
| Compound Name | (8S)-8-(2,4-dichlorophenyl)-10-thiophen-2-yl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
|---|---|
| PubChem CID | 136831399 |
| Molecular Formula | C16H9Cl2N7OS |
| Molecular Weight | 418.27 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | (8S)-8-(2,4-dichlorophenyl)-10-thiophen-2-yl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
| SMILES | O=c1[nH]nc(-c2cccs2)c2c1Nc1nnnn1[C@@H]2c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H9Cl2N7OS/c17-7-3-4-8(9(18)6-7)14-11-12(10-2-1-5-27-10)20-21-15(26)13(11)19-16-22-23-24-25(14)16/h1-6,14H,(H,21,26)(H,19,22,24)/t14-/m1/s1 |
| InChIKey | JQRBHVIPWBJKGL-CQSZACIVSA-N |
| XLogP | 3.49 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.27 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |