C21H12Br2Cl2N2OS2 — CID 136832357
2,4-dibromo-6-[[2-[(2,5-dichlorophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]iminomethyl]phenol (PubChem CID 136832357) has the molecular formula C21H12Br2Cl2N2OS2 and a molecular weight of 603.19 g/mol. Its IUPAC name is 2,4-dibromo-6-[[2-[(2,5-dichlorophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]iminomethyl]phenol.
| Compound Name | 2,4-dibromo-6-[[2-[(2,5-dichlorophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 136832357 |
| Molecular Formula | C21H12Br2Cl2N2OS2 |
| Molecular Weight | 603.19 g/mol |
| Exact Mass | 599.81 |
| IUPAC Name | 2,4-dibromo-6-[[2-[(2,5-dichlorophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]iminomethyl]phenol |
| SMILES | Oc1c(Br)cc(Br)cc1/C=N/c1ccc2nc(SCc3cc(Cl)ccc3Cl)sc2c1 |
| InChI | InChI=1S/C21H12Br2Cl2N2OS2/c22-13-5-11(20(28)16(23)7-13)9-26-15-2-4-18-19(8-15)30-21(27-18)29-10-12-6-14(24)1-3-17(12)25/h1-9,28H,10H2/b26-9+ |
| InChIKey | XNCHFSXTPVGNBN-JQAMDZJQSA-N |
| XLogP | 8.88 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.19 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|