C57H45N5O2 — CID 136832857
2-[[4-[10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]methyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 136832857) has the molecular formula C57H45N5O2 and a molecular weight of 832.02 g/mol. Its IUPAC name is 2-[[4-[10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]methyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[[4-[10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]methyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 136832857 |
| Molecular Formula | C57H45N5O2 |
| Molecular Weight | 832.02 g/mol |
| Exact Mass | 831.36 |
| IUPAC Name | 2-[[4-[10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]methyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | Cc1cc(C)c(-c2c3nc(c(-c4ccc(CN5C(=O)c6cccc7cccc(c67)C5=O)cc4)c4ccc([nH]4)c(-c4c(C)cc(C)cc4C)c4nc(cc5ccc2[nH]5)C=C4)C=C3)c(C)c1 |
| InChI | InChI=1S/C57H45N5O2/c1-31-25-33(3)50(34(4)26-31)54-46-19-17-40(58-46)29-41-18-20-47(59-41)55(51-35(5)27-32(2)28-36(51)6)49-24-22-45(61-49)53(44-21-23-48(54)60-44)39-15-13-37(14-16-39)30-62-56(63)42-11-7-9-38-10-8-12-43(52(38)42)57(62)64/h7-29,58,61H,30H2,1-6H3/b40-29-,41-29-,53-44-,53-45-,54-46+,54-48+,55-47+,55-49+ |
| InChIKey | VSGBZHSKXJFCFA-PONAHFQTSA-N |
| XLogP | 13.46 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.02 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|