C17H19N3O2 — CID 136833027
2-[(1S)-1-[ethyl(furan-3-ylmethyl)amino]ethyl]-3H-quinazolin-4-one (PubChem CID 136833027) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 2-[(1S)-1-[ethyl(furan-3-ylmethyl)amino]ethyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(1S)-1-[ethyl(furan-3-ylmethyl)amino]ethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136833027 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-[(1S)-1-[ethyl(furan-3-ylmethyl)amino]ethyl]-3H-quinazolin-4-one |
| SMILES | CCN(Cc1ccoc1)[C@@H](C)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C17H19N3O2/c1-3-20(10-13-8-9-22-11-13)12(2)16-18-15-7-5-4-6-14(15)17(21)19-16/h4-9,11-12H,3,10H2,1-2H3,(H,18,19,21)/t12-/m0/s1 |
| InChIKey | MLNFZDQLOVNHAI-LBPRGKRZSA-N |
| XLogP | 3.10 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |