About CID 136835222
CID 136835222 (PubChem CID 136835222) has the molecular formula C10H17BNO
and a molecular weight of 178.06 g/mol.
Molecular Properties
| Compound Name | CID 136835222 |
| PubChem CID | 136835222 |
| Molecular Formula | C10H17BNO |
| Molecular Weight | 178.06 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | — |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@H]1N[B]O[C@@H]21 |
| InChI | InChI=1S/C10H17BNO/c1-9(2)6-4-5-10(9,3)8-7(6)13-11-12-8/h6-8,12H,4-5H2,1-3H3/t6-,7+,8+,10+/m1/s1 |
| InChIKey | RNGKSCZPIORGBU-VEVYYDQMSA-N |
| XLogP | 1.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.06 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 136835222 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136835222?
The IUPAC name of CID 136835222 (CID 136835222) is not available.
What is the SMILES notation for CID 136835222?
The canonical SMILES for CID 136835222 is CC1(C)[C@@H]2CC[C@@]1(C)[C@H]1N[B]O[C@@H]21.
What is the InChIKey of CID 136835222?
The InChIKey is RNGKSCZPIORGBU-VEVYYDQMSA-N. The full InChI is InChI=1S/C10H17BNO/c1-9(2)6-4-5-10(9,3)8-7(6)13-11-12-8/h6-8,12H,4-5H2,1-3H3/t6-,7+,8+,10+/m1/s1.
What are the key properties of CID 136835222?
CID 136835222 has a molecular weight of 178.06 g/mol, XLogP of 1.33, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136835222 is sourced from PubChem (CID 136835222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).