C22H20N2O4 — CID 136835617
4,6-bis[1-(2-hydroxyphenyl)ethylideneamino]benzene-1,3-diol (PubChem CID 136835617) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 4,6-bis[1-(2-hydroxyphenyl)ethylideneamino]benzene-1,3-diol.
| Compound Name | 4,6-bis[1-(2-hydroxyphenyl)ethylideneamino]benzene-1,3-diol |
|---|---|
| PubChem CID | 136835617 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 4,6-bis[1-(2-hydroxyphenyl)ethylideneamino]benzene-1,3-diol |
| SMILES | C/C(=N\c1cc(/N=C(\C)c2ccccc2O)c(O)cc1O)c1ccccc1O |
| InChI | InChI=1S/C22H20N2O4/c1-13(15-7-3-5-9-19(15)25)23-17-11-18(22(28)12-21(17)27)24-14(2)16-8-4-6-10-20(16)26/h3-12,25-28H,1-2H3/b23-13+,24-14+ |
| InChIKey | NFVKFEXVICXOJJ-RNIAWFEPSA-N |
| XLogP | 4.79 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|